C29H22N4O3S — CID 24846746
(5Z)-5-[(3-nitrophenyl)methylidene]-3-[(N-phenylanilino)methyl]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 24846746) has the molecular formula C29H22N4O3S and a molecular weight of 506.59 g/mol. Its IUPAC name is (5Z)-5-[(3-nitrophenyl)methylidene]-3-[(N-phenylanilino)methyl]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-nitrophenyl)methylidene]-3-[(N-phenylanilino)methyl]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 24846746 |
| Molecular Formula | C29H22N4O3S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | (5Z)-5-[(3-nitrophenyl)methylidene]-3-[(N-phenylanilino)methyl]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccc([N+](=O)[O-])c2)S/C(=N\c2ccccc2)N1CN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H22N4O3S/c34-28-27(20-22-11-10-18-26(19-22)33(35)36)37-29(30-23-12-4-1-5-13-23)32(28)21-31(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-20H,21H2/b27-20-,30-29- |
| InChIKey | DOGYBCCDPUCVHI-FFKKSUQSSA-N |
| XLogP | 6.99 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|