C36H48Cl2NNaO7 — CID 24847780
sodium;2-[2-(2,6-dichloroanilino)phenyl]acetate;methyl 7-[3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate (PubChem CID 24847780) has the molecular formula C36H48Cl2NNaO7 and a molecular weight of 700.68 g/mol. Its IUPAC name is sodium;2-[2-(2,6-dichloroanilino)phenyl]acetate;methyl 7-[3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | sodium;2-[2-(2,6-dichloroanilino)phenyl]acetate;methyl 7-[3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 24847780 |
| Molecular Formula | C36H48Cl2NNaO7 |
| Molecular Weight | 700.68 g/mol |
| Exact Mass | 699.27 |
| IUPAC Name | sodium;2-[2-(2,6-dichloroanilino)phenyl]acetate;methyl 7-[3-hydroxy-2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCC(C)(O)C/C=C/C1C(O)CC(=O)C1CCCCCCC(=O)OC.O=C([O-])Cc1ccccc1Nc1c(Cl)cccc1Cl.[Na+] |
| InChI | InChI=1S/C22H38O5.C14H11Cl2NO2.Na/c1-4-5-14-22(2,26)15-10-12-18-17(19(23)16-20(18)24)11-8-6-7-9-13-21(25)27-3;15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;/h10,12,17-18,20,24,26H,4-9,11,13-16H2,1-3H3;1-7,17H,8H2,(H,18,19);/q;;+1/p-1/b12-10+;; |
| InChIKey | HDEFOQFNRFJUCB-PFNYCKIMSA-M |
| XLogP | 3.99 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|