C12H10N2O4S-2 — CID 24848640
(E)-but-2-enedioate;5-(thiophen-3-ylmethyl)-1H-imidazole (PubChem CID 24848640) has the molecular formula C12H10N2O4S-2 and a molecular weight of 278.29 g/mol. Its IUPAC name is (E)-but-2-enedioate;5-(thiophen-3-ylmethyl)-1H-imidazole.
| Compound Name | (E)-but-2-enedioate;5-(thiophen-3-ylmethyl)-1H-imidazole |
|---|---|
| PubChem CID | 24848640 |
| Molecular Formula | C12H10N2O4S-2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (E)-but-2-enedioate;5-(thiophen-3-ylmethyl)-1H-imidazole |
| SMILES | O=C([O-])/C=C/C(=O)[O-].c1ncc(Cc2ccsc2)[nH]1 |
| InChI | InChI=1S/C8H8N2S.C4H4O4/c1-2-11-5-7(1)3-8-4-9-6-10-8;5-3(6)1-2-4(7)8/h1-2,4-6H,3H2,(H,9,10);1-2H,(H,5,6)(H,7,8)/p-2/b;2-1+ |
| InChIKey | TVOFNFIHOMKWAP-WLHGVMLRSA-L |
| XLogP | -0.90 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|