C13H11BrN2O5S-2 — CID 24848620
5-[(4-bromothiophen-3-yl)-methoxymethyl]-1H-imidazole;(E)-but-2-enedioate (PubChem CID 24848620) has the molecular formula C13H11BrN2O5S-2 and a molecular weight of 387.21 g/mol. Its IUPAC name is 5-[(4-bromothiophen-3-yl)-methoxymethyl]-1H-imidazole;(E)-but-2-enedioate.
| Compound Name | 5-[(4-bromothiophen-3-yl)-methoxymethyl]-1H-imidazole;(E)-but-2-enedioate |
|---|---|
| PubChem CID | 24848620 |
| Molecular Formula | C13H11BrN2O5S-2 |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 5-[(4-bromothiophen-3-yl)-methoxymethyl]-1H-imidazole;(E)-but-2-enedioate |
| SMILES | COC(c1cnc[nH]1)c1cscc1Br.O=C([O-])/C=C/C(=O)[O-] |
| InChI | InChI=1S/C9H9BrN2OS.C4H4O4/c1-13-9(8-2-11-5-12-8)6-3-14-4-7(6)10;5-3(6)1-2-4(7)8/h2-5,9H,1H3,(H,11,12);1-2H,(H,5,6)(H,7,8)/p-2/b;2-1+ |
| InChIKey | UPQJFBQGNKKZTN-WLHGVMLRSA-L |
| XLogP | 0.01 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|