C14H14N2O4S-2 — CID 24848635
(E)-but-2-enedioate;5-[1-(4-methylthiophen-3-yl)ethyl]-1H-imidazole (PubChem CID 24848635) has the molecular formula C14H14N2O4S-2 and a molecular weight of 306.34 g/mol. Its IUPAC name is (E)-but-2-enedioate;5-[1-(4-methylthiophen-3-yl)ethyl]-1H-imidazole.
| Compound Name | (E)-but-2-enedioate;5-[1-(4-methylthiophen-3-yl)ethyl]-1H-imidazole |
|---|---|
| PubChem CID | 24848635 |
| Molecular Formula | C14H14N2O4S-2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (E)-but-2-enedioate;5-[1-(4-methylthiophen-3-yl)ethyl]-1H-imidazole |
| SMILES | Cc1cscc1C(C)c1cnc[nH]1.O=C([O-])/C=C/C(=O)[O-] |
| InChI | InChI=1S/C10H12N2S.C4H4O4/c1-7-4-13-5-9(7)8(2)10-3-11-6-12-10;5-3(6)1-2-4(7)8/h3-6,8H,1-2H3,(H,11,12);1-2H,(H,5,6)(H,7,8)/p-2/b;2-1+ |
| InChIKey | RFYQZGZNWZRKLZ-WLHGVMLRSA-L |
| XLogP | -0.03 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|