C28H33F3N2O3 — CID 24848799
1-[4-(ethylamino)phenoxy]-3-[methyl-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]propan-2-ol (PubChem CID 24848799) has the molecular formula C28H33F3N2O3 and a molecular weight of 502.58 g/mol. Its IUPAC name is 1-[4-(ethylamino)phenoxy]-3-[methyl-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]propan-2-ol.
| Compound Name | 1-[4-(ethylamino)phenoxy]-3-[methyl-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 24848799 |
| Molecular Formula | C28H33F3N2O3 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 1-[4-(ethylamino)phenoxy]-3-[methyl-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]propan-2-ol |
| SMILES | CCNc1ccc(OCC(O)CN(C)CCC(Oc2ccc(C(F)(F)F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H33F3N2O3/c1-3-32-23-11-15-25(16-12-23)35-20-24(34)19-33(2)18-17-27(21-7-5-4-6-8-21)36-26-13-9-22(10-14-26)28(29,30)31/h4-16,24,27,32,34H,3,17-20H2,1-2H3 |
| InChIKey | IWYTUWMBDRWLJL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|