C23H25BrF3NO — CID 88947630
5-bromo-N,4-dimethyl-N-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]penta-2,3-dien-1-amine (PubChem CID 88947630) has the molecular formula C23H25BrF3NO and a molecular weight of 468.36 g/mol. Its IUPAC name is 5-bromo-N,4-dimethyl-N-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]penta-2,3-dien-1-amine.
| Compound Name | 5-bromo-N,4-dimethyl-N-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]penta-2,3-dien-1-amine |
|---|---|
| PubChem CID | 88947630 |
| Molecular Formula | C23H25BrF3NO |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 5-bromo-N,4-dimethyl-N-[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]penta-2,3-dien-1-amine |
| SMILES | CC(=C=CCN(C)CCC(Oc1ccc(C(F)(F)F)cc1)c1ccccc1)CBr |
| InChI | InChI=1S/C23H25BrF3NO/c1-18(17-24)7-6-15-28(2)16-14-22(19-8-4-3-5-9-19)29-21-12-10-20(11-13-21)23(25,26)27/h3-6,8-13,22H,14-17H2,1-2H3 |
| InChIKey | ZYXBKJXVLUUCOG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|