C17H18FN3O4 — CID 24848851
7-(3-aminopyrrolidin-1-yl)-6-fluoro-1-(oxetan-3-yl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 24848851) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is 7-(3-aminopyrrolidin-1-yl)-6-fluoro-1-(oxetan-3-yl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(3-aminopyrrolidin-1-yl)-6-fluoro-1-(oxetan-3-yl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 24848851 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 7-(3-aminopyrrolidin-1-yl)-6-fluoro-1-(oxetan-3-yl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | NC1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2COC2)C1 |
| InChI | InChI=1S/C17H18FN3O4/c18-13-3-11-14(4-15(13)20-2-1-9(19)5-20)21(10-7-25-8-10)6-12(16(11)22)17(23)24/h3-4,6,9-10H,1-2,5,7-8,19H2,(H,23,24) |
| InChIKey | SRLGACOUAXBWJR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |