C28H34N6O3 — CID 24848883
2-(dimethylamino)-N-[(2R)-2-[[(1R)-1-formamido-2-(1H-indol-3-yl)ethyl]amino]-3-(1H-indol-3-yl)propanoyl]-2-methylpropanamide (PubChem CID 24848883) has the molecular formula C28H34N6O3 and a molecular weight of 502.62 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[(2R)-2-[[(1R)-1-formamido-2-(1H-indol-3-yl)ethyl]amino]-3-(1H-indol-3-yl)propanoyl]-2-methylpropanamide.
| Compound Name | 2-(dimethylamino)-N-[(2R)-2-[[(1R)-1-formamido-2-(1H-indol-3-yl)ethyl]amino]-3-(1H-indol-3-yl)propanoyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 24848883 |
| Molecular Formula | C28H34N6O3 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 2-(dimethylamino)-N-[(2R)-2-[[(1R)-1-formamido-2-(1H-indol-3-yl)ethyl]amino]-3-(1H-indol-3-yl)propanoyl]-2-methylpropanamide |
| SMILES | CN(C)C(C)(C)C(=O)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)N[C@@H](Cc1c[nH]c2ccccc12)NC=O |
| InChI | InChI=1S/C28H34N6O3/c1-28(2,34(3)4)27(37)33-26(36)24(13-18-15-29-22-11-7-5-9-20(18)22)32-25(31-17-35)14-19-16-30-23-12-8-6-10-21(19)23/h5-12,15-17,24-25,29-30,32H,13-14H2,1-4H3,(H,31,35)(H,33,36,37)/t24-,25+/m1/s1 |
| InChIKey | AFTFAAINOMFFLM-RPBOFIJWSA-N |
| XLogP | 2.45 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|