(3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate

C18H22N2O4 — CID 24851364

IUPAC(3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate
SMILESCCN(CC)C(=O)Oc1cc(OC)cc(OC)c1-c1ccncc1
InChIInChI=1S/C18H22N2O4/c1-5-20(6-2)18(21)24-16-12-14(22-3)11-15(23-4)17(16)13-7-9-19-10-8-13/h7-12H,5-6H2,1-4H3
InChIKeyWPVJHGLRMMTHQB-UHFFFAOYSA-N
MW330.38 g/mol
LogP3.61
Rot. Bonds6

About (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate

(3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate (PubChem CID 24851364) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate.

Molecular Properties

Compound Name(3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate
PubChem CID24851364
Molecular FormulaC18H22N2O4
Molecular Weight330.38 g/mol
Exact Mass330.16
IUPAC Name(3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate
SMILESCCN(CC)C(=O)Oc1cc(OC)cc(OC)c1-c1ccncc1
InChIInChI=1S/C18H22N2O4/c1-5-20(6-2)18(21)24-16-12-14(22-3)11-15(23-4)17(16)13-7-9-19-10-8-13/h7-12H,5-6H2,1-4H3
InChIKeyWPVJHGLRMMTHQB-UHFFFAOYSA-N
XLogP3.61
TPSA60.89 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.38
LogP ≤ 53.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate?
The IUPAC name of (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate (CID 24851364) is (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate.
What is the SMILES notation for (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate?
The canonical SMILES for (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate is CCN(CC)C(=O)Oc1cc(OC)cc(OC)c1-c1ccncc1.
What is the InChIKey of (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate?
The InChIKey is WPVJHGLRMMTHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O4/c1-5-20(6-2)18(21)24-16-12-14(22-3)11-15(23-4)17(16)13-7-9-19-10-8-13/h7-12H,5-6H2,1-4H3.
What are the key properties of (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate?
(3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate has a molecular weight of 330.38 g/mol, XLogP of 3.61, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate is sourced from PubChem (CID 24851364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).