C18H22N2O4 — CID 24851364
(3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate (PubChem CID 24851364) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate.
| Compound Name | (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 24851364 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (3,5-dimethoxy-2-pyridin-4-ylphenyl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cc(OC)cc(OC)c1-c1ccncc1 |
| InChI | InChI=1S/C18H22N2O4/c1-5-20(6-2)18(21)24-16-12-14(22-3)11-15(23-4)17(16)13-7-9-19-10-8-13/h7-12H,5-6H2,1-4H3 |
| InChIKey | WPVJHGLRMMTHQB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |