C25H30ClN3O5S — CID 24852485
4-(4-chlorophenoxy)-N-(1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide (PubChem CID 24852485) has the molecular formula C25H30ClN3O5S and a molecular weight of 520.05 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-(1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-(4-chlorophenoxy)-N-(1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 24852485 |
| Molecular Formula | C25H30ClN3O5S |
| Molecular Weight | 520.05 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-(1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl)-N-(2-piperidin-1-ylethyl)benzenesulfonamide |
| SMILES | O=C1C(N(CCN2CCCCC2)S(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)CC=CCN1O |
| InChI | InChI=1S/C25H30ClN3O5S/c26-20-7-9-21(10-8-20)34-22-11-13-23(14-12-22)35(32,33)29(19-18-27-15-3-1-4-16-27)24-6-2-5-17-28(31)25(24)30/h2,5,7-14,24,31H,1,3-4,6,15-19H2 |
| InChIKey | SRFKWSJTGCWGBQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.05 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|