C18H17ClN2O5S — CID 24852135
4-(4-chlorophenoxy)-N-(1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl)benzenesulfonamide (PubChem CID 24852135) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-(1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl)benzenesulfonamide.
| Compound Name | 4-(4-chlorophenoxy)-N-(1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 24852135 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-(1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl)benzenesulfonamide |
| SMILES | O=C1C(NS(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)CC=CCN1O |
| InChI | InChI=1S/C18H17ClN2O5S/c19-13-4-6-14(7-5-13)26-15-8-10-16(11-9-15)27(24,25)20-17-3-1-2-12-21(23)18(17)22/h1-2,4-11,17,20,23H,3,12H2 |
| InChIKey | GETDIWSMCUZGCD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|