C32H41N5OS — CID 24852870
3-(1,3-benzothiazol-2-yl)-1-[2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]ethyl]-1-(3,3-diphenylpropyl)urea (PubChem CID 24852870) has the molecular formula C32H41N5OS and a molecular weight of 543.78 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1-[2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]ethyl]-1-(3,3-diphenylpropyl)urea.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1-[2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]ethyl]-1-(3,3-diphenylpropyl)urea |
|---|---|
| PubChem CID | 24852870 |
| Molecular Formula | C32H41N5OS |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1-[2-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]ethyl]-1-(3,3-diphenylpropyl)urea |
| SMILES | CN(C)CC(C)(C)CNCCN(CCC(c1ccccc1)c1ccccc1)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C32H41N5OS/c1-32(2,24-36(3)4)23-33-20-22-37(31(38)35-30-34-28-17-11-12-18-29(28)39-30)21-19-27(25-13-7-5-8-14-25)26-15-9-6-10-16-26/h5-18,27,33H,19-24H2,1-4H3,(H,34,35,38) |
| InChIKey | MLFHTGGBDCTOND-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|