C30H29N5O — CID 24857487
1-(3-benzylphenyl)-3-[4-(6-tert-butyl-1H-pyrazolo[5,4-b]pyridin-4-yl)phenyl]urea (PubChem CID 24857487) has the molecular formula C30H29N5O and a molecular weight of 475.60 g/mol. Its IUPAC name is 1-(3-benzylphenyl)-3-[4-(6-tert-butyl-1H-pyrazolo[5,4-b]pyridin-4-yl)phenyl]urea.
| Compound Name | 1-(3-benzylphenyl)-3-[4-(6-tert-butyl-1H-pyrazolo[5,4-b]pyridin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 24857487 |
| Molecular Formula | C30H29N5O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 1-(3-benzylphenyl)-3-[4-(6-tert-butyl-1H-pyrazolo[5,4-b]pyridin-4-yl)phenyl]urea |
| SMILES | CC(C)(C)c1cc(-c2ccc(NC(=O)Nc3cccc(Cc4ccccc4)c3)cc2)c2cn[nH]c2n1 |
| InChI | InChI=1S/C30H29N5O/c1-30(2,3)27-18-25(26-19-31-35-28(26)34-27)22-12-14-23(15-13-22)32-29(36)33-24-11-7-10-21(17-24)16-20-8-5-4-6-9-20/h4-15,17-19H,16H2,1-3H3,(H,31,34,35)(H2,32,33,36) |
| InChIKey | QZAPNYGVMXBXMM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |