C26H26F3N5O4 — CID 51040341
1-[4-[6-[2-(2-methoxyethoxy)ethylamino]-1H-indazol-4-yl]phenyl]-3-[3-(trifluoromethoxy)phenyl]urea (PubChem CID 51040341) has the molecular formula C26H26F3N5O4 and a molecular weight of 529.52 g/mol. Its IUPAC name is 1-[4-[6-[2-(2-methoxyethoxy)ethylamino]-1H-indazol-4-yl]phenyl]-3-[3-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-[6-[2-(2-methoxyethoxy)ethylamino]-1H-indazol-4-yl]phenyl]-3-[3-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 51040341 |
| Molecular Formula | C26H26F3N5O4 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 1-[4-[6-[2-(2-methoxyethoxy)ethylamino]-1H-indazol-4-yl]phenyl]-3-[3-(trifluoromethoxy)phenyl]urea |
| SMILES | COCCOCCNc1cc(-c2ccc(NC(=O)Nc3cccc(OC(F)(F)F)c3)cc2)c2cn[nH]c2c1 |
| InChI | InChI=1S/C26H26F3N5O4/c1-36-11-12-37-10-9-30-20-14-22(23-16-31-34-24(23)15-20)17-5-7-18(8-6-17)32-25(35)33-19-3-2-4-21(13-19)38-26(27,28)29/h2-8,13-16,30H,9-12H2,1H3,(H,31,34)(H2,32,33,35) |
| InChIKey | CVMZLUOUHUPTLO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 109.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|