C26H26F3N5O5S — CID 123695772
2-methoxyethyl N-[dihydroxy-[4-[4-[1-[3-(trifluoromethoxy)anilino]ethylideneamino]phenyl]-1H-indazol-6-yl]-λ4-sulfanyl]methanimidate (PubChem CID 123695772) has the molecular formula C26H26F3N5O5S and a molecular weight of 577.59 g/mol. Its IUPAC name is 2-methoxyethyl N-[dihydroxy-[4-[4-[1-[3-(trifluoromethoxy)anilino]ethylideneamino]phenyl]-1H-indazol-6-yl]-λ4-sulfanyl]methanimidate.
| Compound Name | 2-methoxyethyl N-[dihydroxy-[4-[4-[1-[3-(trifluoromethoxy)anilino]ethylideneamino]phenyl]-1H-indazol-6-yl]-λ4-sulfanyl]methanimidate |
|---|---|
| PubChem CID | 123695772 |
| Molecular Formula | C26H26F3N5O5S |
| Molecular Weight | 577.59 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | 2-methoxyethyl N-[dihydroxy-[4-[4-[1-[3-(trifluoromethoxy)anilino]ethylideneamino]phenyl]-1H-indazol-6-yl]-λ4-sulfanyl]methanimidate |
| SMILES | COCCOC=NS(O)(O)c1cc(-c2ccc(/N=C(\C)Nc3cccc(OC(F)(F)F)c3)cc2)c2cn[nH]c2c1 |
| InChI | InChI=1S/C26H26F3N5O5S/c1-17(33-20-4-3-5-21(12-20)39-26(27,28)29)32-19-8-6-18(7-9-19)23-13-22(14-25-24(23)15-30-34-25)40(35,36)31-16-38-11-10-37-2/h3-9,12-16,35-36H,10-11H2,1-2H3,(H,30,34)(H,32,33) |
| InChIKey | XKNHGALTFKLAKE-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.59 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|