C10H13N5O4S3 — CID 24857853
2-(2-ethylsulfonylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole (PubChem CID 24857853) has the molecular formula C10H13N5O4S3 and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-(2-ethylsulfonylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(2-ethylsulfonylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 24857853 |
| Molecular Formula | C10H13N5O4S3 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 2-(2-ethylsulfonylethylsulfanyl)-5-(1-methyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazole |
| SMILES | CCS(=O)(=O)CCSc1nnc(-c2ncc([N+](=O)[O-])n2C)s1 |
| InChI | InChI=1S/C10H13N5O4S3/c1-3-22(18,19)5-4-20-10-13-12-9(21-10)8-11-6-7(14(8)2)15(16)17/h6H,3-5H2,1-2H3 |
| InChIKey | WJZYJSDJJVZPRS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|