C24H33N5O3 — CID 24859081
tert-butyl 4-[[3-[[formyl-[(6-methyl-3-pyridinyl)amino]amino]methyl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 24859081) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is tert-butyl 4-[[3-[[formyl-[(6-methyl-3-pyridinyl)amino]amino]methyl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-[[formyl-[(6-methyl-3-pyridinyl)amino]amino]methyl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 24859081 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | tert-butyl 4-[[3-[[formyl-[(6-methyl-3-pyridinyl)amino]amino]methyl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(NN(C=O)Cc2cccc(CN3CCN(C(=O)OC(C)(C)C)CC3)c2)cn1 |
| InChI | InChI=1S/C24H33N5O3/c1-19-8-9-22(15-25-19)26-29(18-30)17-21-7-5-6-20(14-21)16-27-10-12-28(13-11-27)23(31)32-24(2,3)4/h5-9,14-15,18,26H,10-13,16-17H2,1-4H3 |
| InChIKey | NUDJGLHWXBRXIK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|