C25H27NO5S — CID 24859766
methyl 2-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]-3-(3-hydroxyphenyl)propanoate (PubChem CID 24859766) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is methyl 2-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]-3-(3-hydroxyphenyl)propanoate.
| Compound Name | methyl 2-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]-3-(3-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 24859766 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | methyl 2-[[benzyl-(4-methylphenyl)sulfonylamino]methyl]-3-(3-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C(Cc1cccc(O)c1)CN(Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H27NO5S/c1-19-11-13-24(14-12-19)32(29,30)26(17-20-7-4-3-5-8-20)18-22(25(28)31-2)15-21-9-6-10-23(27)16-21/h3-14,16,22,27H,15,17-18H2,1-2H3 |
| InChIKey | ZEIQBRMCNGYVKT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |