C22H24N2O2 — CID 24865641
8-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-5-phenyl-2,3,5,6-tetrahydro-4,1-benzoxazocine (PubChem CID 24865641) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 8-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-5-phenyl-2,3,5,6-tetrahydro-4,1-benzoxazocine.
| Compound Name | 8-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-5-phenyl-2,3,5,6-tetrahydro-4,1-benzoxazocine |
|---|---|
| PubChem CID | 24865641 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 8-(3,5-dimethyl-1,2-oxazol-4-yl)-1-methyl-5-phenyl-2,3,5,6-tetrahydro-4,1-benzoxazocine |
| SMILES | Cc1noc(C)c1-c1ccc2c(c1)CC(c1ccccc1)OCCN2C |
| InChI | InChI=1S/C22H24N2O2/c1-15-22(16(2)26-23-15)18-9-10-20-19(13-18)14-21(25-12-11-24(20)3)17-7-5-4-6-8-17/h4-10,13,21H,11-12,14H2,1-3H3 |
| InChIKey | RXYSVNWBTADQRP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |