C22H24N2O2 — CID 68840094
9-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methyl-1-phenyl-2,3,5,6-tetrahydro-4,1-benzoxazocine (PubChem CID 68840094) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 9-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methyl-1-phenyl-2,3,5,6-tetrahydro-4,1-benzoxazocine.
| Compound Name | 9-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methyl-1-phenyl-2,3,5,6-tetrahydro-4,1-benzoxazocine |
|---|---|
| PubChem CID | 68840094 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 9-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methyl-1-phenyl-2,3,5,6-tetrahydro-4,1-benzoxazocine |
| SMILES | Cc1noc(C)c1-c1ccc2c(c1)N(c1ccccc1)CCOC(C)C2 |
| InChI | InChI=1S/C22H24N2O2/c1-15-13-18-9-10-19(22-16(2)23-26-17(22)3)14-21(18)24(11-12-25-15)20-7-5-4-6-8-20/h4-10,14-15H,11-13H2,1-3H3 |
| InChIKey | BBOVWHBEZONIRG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|