C28H37N5O8 — CID 24867922
tert-butyl N-[1-[[5-(4-acetamido-2-oxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-1-oxo-3-phenylmethoxybutan-2-yl]carbamate (PubChem CID 24867922) has the molecular formula C28H37N5O8 and a molecular weight of 571.63 g/mol. Its IUPAC name is tert-butyl N-[1-[[5-(4-acetamido-2-oxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-1-oxo-3-phenylmethoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[5-(4-acetamido-2-oxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-1-oxo-3-phenylmethoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 24867922 |
| Molecular Formula | C28H37N5O8 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | tert-butyl N-[1-[[5-(4-acetamido-2-oxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-1-oxo-3-phenylmethoxybutan-2-yl]carbamate |
| SMILES | CC(=O)Nc1ccn(C2CC3OCC(NC(=O)C(NC(=O)OC(C)(C)C)C(C)OCc4ccccc4)C3O2)c(=O)n1 |
| InChI | InChI=1S/C28H37N5O8/c1-16(38-14-18-9-7-6-8-10-18)23(32-27(37)41-28(3,4)5)25(35)30-19-15-39-20-13-22(40-24(19)20)33-12-11-21(29-17(2)34)31-26(33)36/h6-12,16,19-20,22-24H,13-15H2,1-5H3,(H,30,35)(H,32,37)(H,29,31,34,36) |
| InChIKey | KSOUORGQXKPQCO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 159.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |