C26H34N4O8 — CID 24867961
tert-butyl N-[1-[[5-(2,4-dioxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-1-oxo-3-phenylmethoxybutan-2-yl]carbamate (PubChem CID 24867961) has the molecular formula C26H34N4O8 and a molecular weight of 530.58 g/mol. Its IUPAC name is tert-butyl N-[1-[[5-(2,4-dioxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-1-oxo-3-phenylmethoxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[5-(2,4-dioxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-1-oxo-3-phenylmethoxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 24867961 |
| Molecular Formula | C26H34N4O8 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | tert-butyl N-[1-[[5-(2,4-dioxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-1-oxo-3-phenylmethoxybutan-2-yl]carbamate |
| SMILES | CC(OCc1ccccc1)C(NC(=O)OC(C)(C)C)C(=O)NC1COC2CC(n3ccc(=O)[nH]c3=O)OC12 |
| InChI | InChI=1S/C26H34N4O8/c1-15(35-13-16-8-6-5-7-9-16)21(29-25(34)38-26(2,3)4)23(32)27-17-14-36-18-12-20(37-22(17)18)30-11-10-19(31)28-24(30)33/h5-11,15,17-18,20-22H,12-14H2,1-4H3,(H,27,32)(H,29,34)(H,28,31,33) |
| InChIKey | XOOFRCQZUWNQQU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |