C21H30N4O7 — CID 24867987
tert-butyl 2-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 24867987) has the molecular formula C21H30N4O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is tert-butyl 2-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 24867987 |
| Molecular Formula | C21H30N4O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | tert-butyl 2-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1cn(C2CC3OCC(NC(=O)C4CCCN4C(=O)OC(C)(C)C)C3O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H30N4O7/c1-11-9-25(19(28)23-17(11)26)15-8-14-16(31-15)12(10-30-14)22-18(27)13-6-5-7-24(13)20(29)32-21(2,3)4/h9,12-16H,5-8,10H2,1-4H3,(H,22,27)(H,23,26,28) |
| InChIKey | ONBBUERXJAQIIW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |