C26H23N3O6S — CID 24871753
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(3-methylsulfonylphenyl)phenyl]imidazolidine-2,4-dione (PubChem CID 24871753) has the molecular formula C26H23N3O6S and a molecular weight of 505.55 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(3-methylsulfonylphenyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(3-methylsulfonylphenyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24871753 |
| Molecular Formula | C26H23N3O6S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(3-methylsulfonylphenyl)phenyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(c3ccc(-c4cccc(S(C)(=O)=O)c4)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C26H23N3O6S/c1-35-20-11-8-18-14-29(23(30)22(18)13-20)15-26(24(31)27-25(32)28-26)19-9-6-16(7-10-19)17-4-3-5-21(12-17)36(2,33)34/h3-13H,14-15H2,1-2H3,(H2,27,28,31,32) |
| InChIKey | FUONZAWXDCJXOG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|