C28H25N5O4 — CID 70792495
(5R)-5-[(5-ethoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(1-methylindazol-5-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 70792495) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is (5R)-5-[(5-ethoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(1-methylindazol-5-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-ethoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(1-methylindazol-5-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70792495 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | (5R)-5-[(5-ethoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(1-methylindazol-5-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | CCOc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(-c4ccc5c(cnn5C)c4)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C28H25N5O4/c1-3-37-22-10-6-19-15-33(25(34)23(19)13-22)16-28(26(35)30-27(36)31-28)21-8-4-17(5-9-21)18-7-11-24-20(12-18)14-29-32(24)2/h4-14H,3,15-16H2,1-2H3,(H2,30,31,35,36)/t28-/m0/s1 |
| InChIKey | AWLJFRHANOLURC-NDEPHWFRSA-N |
| XLogP | 3.33 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|