C27H21N5O4 — CID 71176740
(5R)-5-[(5-aminooxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-quinolin-8-ylphenyl)imidazolidine-2,4-dione (PubChem CID 71176740) has the molecular formula C27H21N5O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is (5R)-5-[(5-aminooxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-quinolin-8-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-aminooxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-quinolin-8-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71176740 |
| Molecular Formula | C27H21N5O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | (5R)-5-[(5-aminooxy-3-oxo-1H-isoindol-2-yl)methyl]-5-(4-quinolin-8-ylphenyl)imidazolidine-2,4-dione |
| SMILES | NOc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(-c4cccc5cccnc45)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C27H21N5O4/c28-36-20-11-8-18-14-32(24(33)22(18)13-20)15-27(25(34)30-26(35)31-27)19-9-6-16(7-10-19)21-5-1-3-17-4-2-12-29-23(17)21/h1-13H,14-15,28H2,(H2,30,31,34,35)/t27-/m0/s1 |
| InChIKey | ULRVYRKXYRMENJ-MHZLTWQESA-N |
| XLogP | 2.85 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|