C17H13FN4O3 — CID 143512922
(5R)-5-(4-fluorophenyl)-5-[(5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl)methyl]imidazolidine-2,4-dione (PubChem CID 143512922) has the molecular formula C17H13FN4O3 and a molecular weight of 340.31 g/mol. Its IUPAC name is (5R)-5-(4-fluorophenyl)-5-[(5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(4-fluorophenyl)-5-[(5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143512922 |
| Molecular Formula | C17H13FN4O3 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (5R)-5-(4-fluorophenyl)-5-[(5-oxo-7H-pyrrolo[3,4-b]pyridin-6-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](CN2Cc3ncccc3C2=O)(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C17H13FN4O3/c18-11-5-3-10(4-6-11)17(15(24)20-16(25)21-17)9-22-8-13-12(14(22)23)2-1-7-19-13/h1-7H,8-9H2,(H2,20,21,24,25)/t17-/m0/s1 |
| InChIKey | ZIXYYCXFXXELBT-KRWDZBQOSA-N |
| XLogP | 0.91 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|