C23H17FN4O4 — CID 11604430
5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-oxo-1H-pyridin-3-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 11604430) has the molecular formula C23H17FN4O4 and a molecular weight of 432.41 g/mol. Its IUPAC name is 5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-oxo-1H-pyridin-3-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-oxo-1H-pyridin-3-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11604430 |
| Molecular Formula | C23H17FN4O4 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-oxo-1H-pyridin-3-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CN2Cc3ccc(F)cc3C2=O)(c2ccc(-c3ccc[nH]c3=O)cc2)N1 |
| InChI | InChI=1S/C23H17FN4O4/c24-16-8-5-14-11-28(20(30)18(14)10-16)12-23(21(31)26-22(32)27-23)15-6-3-13(4-7-15)17-2-1-9-25-19(17)29/h1-10H,11-12H2,(H,25,29)(H2,26,27,31,32) |
| InChIKey | LZARBPSZHNHACA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|