C27H22FN5O3 — CID 143510078
(5R)-5-[4-(3-ethyl-2H-indazol-5-yl)phenyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 143510078) has the molecular formula C27H22FN5O3 and a molecular weight of 483.50 g/mol. Its IUPAC name is (5R)-5-[4-(3-ethyl-2H-indazol-5-yl)phenyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-(3-ethyl-2H-indazol-5-yl)phenyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510078 |
| Molecular Formula | C27H22FN5O3 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | (5R)-5-[4-(3-ethyl-2H-indazol-5-yl)phenyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CCc1[nH]nc2ccc(-c3ccc([C@]4(CN5Cc6ccc(F)cc6C5=O)NC(=O)NC4=O)cc3)cc12 |
| InChI | InChI=1S/C27H22FN5O3/c1-2-22-21-11-16(6-10-23(21)32-31-22)15-3-7-18(8-4-15)27(25(35)29-26(36)30-27)14-33-13-17-5-9-19(28)12-20(17)24(33)34/h3-12H,2,13-14H2,1H3,(H,31,32)(H2,29,30,35,36)/t27-/m0/s1 |
| InChIKey | PIFSORIFMHXJMN-MHZLTWQESA-N |
| XLogP | 3.62 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|