C29H24FN3O3 — CID 143510278
(5R)-5-[4-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl]phenyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 143510278) has the molecular formula C29H24FN3O3 and a molecular weight of 481.53 g/mol. Its IUPAC name is (5R)-5-[4-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl]phenyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl]phenyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510278 |
| Molecular Formula | C29H24FN3O3 |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (5R)-5-[4-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl]phenyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | C=C/C=C\c1cc(-c2ccc([C@]3(CN4Cc5ccc(F)cc5C4=O)NC(=O)NC3=O)cc2)ccc1C |
| InChI | InChI=1S/C29H24FN3O3/c1-3-4-5-20-14-21(7-6-18(20)2)19-8-11-23(12-9-19)29(27(35)31-28(36)32-29)17-33-16-22-10-13-24(30)15-25(22)26(33)34/h3-15H,1,16-17H2,2H3,(H2,31,32,35,36)/b5-4-/t29-/m0/s1 |
| InChIKey | IBHXYKANHYFVSB-JDIDTKHOSA-N |
| XLogP | 4.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|