C23H21N5O4 — CID 24889700
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[3-(2-methyl-1H-imidazol-5-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 24889700) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[3-(2-methyl-1H-imidazol-5-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[3-(2-methyl-1H-imidazol-5-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24889700 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[3-(2-methyl-1H-imidazol-5-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(c3cccc(-c4cnc(C)[nH]4)c3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C23H21N5O4/c1-13-24-10-19(25-13)14-4-3-5-16(8-14)23(21(30)26-22(31)27-23)12-28-11-15-6-7-17(32-2)9-18(15)20(28)29/h3-10H,11-12H2,1-2H3,(H,24,25)(H2,26,27,30,31) |
| InChIKey | XQENCQSXEUCBOJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|