C21H16N6O4 — CID 52941225
(5R)-5-[2-(1H-imidazo[4,5-b]pyridin-6-yl)ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 52941225) has the molecular formula C21H16N6O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is (5R)-5-[2-(1H-imidazo[4,5-b]pyridin-6-yl)ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-(1H-imidazo[4,5-b]pyridin-6-yl)ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52941225 |
| Molecular Formula | C21H16N6O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (5R)-5-[2-(1H-imidazo[4,5-b]pyridin-6-yl)ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3cnc4nc[nH]c4c3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C21H16N6O4/c1-31-14-3-2-13-9-27(18(28)15(13)7-14)10-21(19(29)25-20(30)26-21)5-4-12-6-16-17(22-8-12)24-11-23-16/h2-3,6-8,11H,9-10H2,1H3,(H,22,23,24)(H2,25,26,29,30)/t21-/m1/s1 |
| InChIKey | JXDVPBBUPYQRGT-OAQYLSRUSA-N |
| XLogP | 0.55 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|