C20H19F2N3O2 — CID 24877307
4-[[6-(2,4-difluorophenoxy)quinazolin-2-yl]amino]cyclohexan-1-ol (PubChem CID 24877307) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 4-[[6-(2,4-difluorophenoxy)quinazolin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[6-(2,4-difluorophenoxy)quinazolin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 24877307 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-[[6-(2,4-difluorophenoxy)quinazolin-2-yl]amino]cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2ncc3cc(Oc4ccc(F)cc4F)ccc3n2)CC1 |
| InChI | InChI=1S/C20H19F2N3O2/c21-13-1-8-19(17(22)10-13)27-16-6-7-18-12(9-16)11-23-20(25-18)24-14-2-4-15(26)5-3-14/h1,6-11,14-15,26H,2-5H2,(H,23,24,25) |
| InChIKey | XMWJUUQCEQEIKY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |