C27H28Cl2N2O6S — CID 24877345
2-[4-[(2,4-dichlorophenyl)methoxy]-3-[[4-(4-methylphenyl)sulfonyl-1-oxidopiperazin-1-ium-1-yl]methyl]phenyl]acetic acid (PubChem CID 24877345) has the molecular formula C27H28Cl2N2O6S and a molecular weight of 579.50 g/mol. Its IUPAC name is 2-[4-[(2,4-dichlorophenyl)methoxy]-3-[[4-(4-methylphenyl)sulfonyl-1-oxidopiperazin-1-ium-1-yl]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(2,4-dichlorophenyl)methoxy]-3-[[4-(4-methylphenyl)sulfonyl-1-oxidopiperazin-1-ium-1-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 24877345 |
| Molecular Formula | C27H28Cl2N2O6S |
| Molecular Weight | 579.50 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | 2-[4-[(2,4-dichlorophenyl)methoxy]-3-[[4-(4-methylphenyl)sulfonyl-1-oxidopiperazin-1-ium-1-yl]methyl]phenyl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[N+]([O-])(Cc3cc(CC(=O)O)ccc3OCc3ccc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C27H28Cl2N2O6S/c1-19-2-7-24(8-3-19)38(35,36)30-10-12-31(34,13-11-30)17-22-14-20(15-27(32)33)4-9-26(22)37-18-21-5-6-23(28)16-25(21)29/h2-9,14,16H,10-13,15,17-18H2,1H3,(H,32,33) |
| InChIKey | LEOYQQGPNQFQAN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|