C13H28N4 — CID 24879444
1-(7-aminoheptyl)-2-(3-methylbut-2-enyl)guanidine (PubChem CID 24879444) has the molecular formula C13H28N4 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-(7-aminoheptyl)-2-(3-methylbut-2-enyl)guanidine.
| Compound Name | 1-(7-aminoheptyl)-2-(3-methylbut-2-enyl)guanidine |
|---|---|
| PubChem CID | 24879444 |
| Molecular Formula | C13H28N4 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | 1-(7-aminoheptyl)-2-(3-methylbut-2-enyl)guanidine |
| SMILES | CC(C)=CC/N=C(\N)NCCCCCCCN |
| InChI | InChI=1S/C13H28N4/c1-12(2)8-11-17-13(15)16-10-7-5-3-4-6-9-14/h8H,3-7,9-11,14H2,1-2H3,(H3,15,16,17) |
| InChIKey | GKQATWDVXXXSOL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|