C38H66ClNO2 — CID 24881123
3-[(8R,9S,13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]propyl-methyl-dioctylazanium chloride (PubChem CID 24881123) has the molecular formula C38H66ClNO2 and a molecular weight of 604.40 g/mol. Its IUPAC name is 3-[(8R,9S,13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]propyl-methyl-dioctylazanium chloride.
| Compound Name | 3-[(8R,9S,13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]propyl-methyl-dioctylazanium chloride |
|---|---|
| PubChem CID | 24881123 |
| Molecular Formula | C38H66ClNO2 |
| Molecular Weight | 604.40 g/mol |
| Exact Mass | 603.48 |
| IUPAC Name | 3-[(8R,9S,13S,17R)-3,17-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]propyl-methyl-dioctylazanium chloride |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCC[C@]1(O)CCC2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@@]21C.[Cl-] |
| InChI | InChI=1S/C38H65NO2.ClH/c1-5-7-9-11-13-15-27-39(4,28-16-14-12-10-8-6-2)29-17-24-38(41)26-23-36-35-20-18-31-30-32(40)19-21-33(31)34(35)22-25-37(36,38)3;/h19,21,30,34-36,41H,5-18,20,22-29H2,1-4H3;1H/t34-,35-,36?,37+,38+;/m1./s1 |
| InChIKey | RWYKWZAXUGFJKM-RMPYZALWSA-N |
| XLogP | 6.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.40 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|