C18H20O2 — CID 24881473
4-hydroxy-1,6-diphenylhexan-2-one (PubChem CID 24881473) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-hydroxy-1,6-diphenylhexan-2-one.
| Compound Name | 4-hydroxy-1,6-diphenylhexan-2-one |
|---|---|
| PubChem CID | 24881473 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-hydroxy-1,6-diphenylhexan-2-one |
| SMILES | O=C(Cc1ccccc1)CC(O)CCc1ccccc1 |
| InChI | InChI=1S/C18H20O2/c19-17(12-11-15-7-3-1-4-8-15)14-18(20)13-16-9-5-2-6-10-16/h1-10,17,19H,11-14H2 |
| InChIKey | YSUOVCJQANDGMA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |