C22H32N2O4 — CID 24885233
cyclopentyl 4-[4-(2-methoxyanilino)-4-oxobutyl]piperidine-1-carboxylate (PubChem CID 24885233) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is cyclopentyl 4-[4-(2-methoxyanilino)-4-oxobutyl]piperidine-1-carboxylate.
| Compound Name | cyclopentyl 4-[4-(2-methoxyanilino)-4-oxobutyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24885233 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | cyclopentyl 4-[4-(2-methoxyanilino)-4-oxobutyl]piperidine-1-carboxylate |
| SMILES | COc1ccccc1NC(=O)CCCC1CCN(C(=O)OC2CCCC2)CC1 |
| InChI | InChI=1S/C22H32N2O4/c1-27-20-11-5-4-10-19(20)23-21(25)12-6-7-17-13-15-24(16-14-17)22(26)28-18-8-2-3-9-18/h4-5,10-11,17-18H,2-3,6-9,12-16H2,1H3,(H,23,25) |
| InChIKey | JJIIQJOTAQURIV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |