C25H29N7S — CID 24885838
(2Z)-2-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-(4-phenyl-3H-1,3-thiazol-2-ylidene)acetonitrile (PubChem CID 24885838) has the molecular formula C25H29N7S and a molecular weight of 459.62 g/mol. Its IUPAC name is (2Z)-2-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-(4-phenyl-3H-1,3-thiazol-2-ylidene)acetonitrile.
| Compound Name | (2Z)-2-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-(4-phenyl-3H-1,3-thiazol-2-ylidene)acetonitrile |
|---|---|
| PubChem CID | 24885838 |
| Molecular Formula | C25H29N7S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (2Z)-2-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-(dimethylamino)-1,3,5-triazin-2-yl]-2-(4-phenyl-3H-1,3-thiazol-2-ylidene)acetonitrile |
| SMILES | CN(C)c1nc(/C(C#N)=C2/NC(c3ccccc3)=CS2)nc(N2CCCC3CCCCC32)n1 |
| InChI | InChI=1S/C25H29N7S/c1-31(2)24-28-22(19(15-26)23-27-20(16-33-23)17-9-4-3-5-10-17)29-25(30-24)32-14-8-12-18-11-6-7-13-21(18)32/h3-5,9-10,16,18,21,27H,6-8,11-14H2,1-2H3/b23-19- |
| InChIKey | MHYOFUTWFIIFIU-NMWGTECJSA-N |
| XLogP | 4.62 |
| TPSA | 80.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|