C27H16Cl2F6N4O2 — CID 24891270
4,6-bis[4-chloro-3-(trifluoromethyl)phenoxy]-2-(1-methylindol-6-yl)pyrimidin-5-amine (PubChem CID 24891270) has the molecular formula C27H16Cl2F6N4O2 and a molecular weight of 613.35 g/mol. Its IUPAC name is 4,6-bis[4-chloro-3-(trifluoromethyl)phenoxy]-2-(1-methylindol-6-yl)pyrimidin-5-amine.
| Compound Name | 4,6-bis[4-chloro-3-(trifluoromethyl)phenoxy]-2-(1-methylindol-6-yl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 24891270 |
| Molecular Formula | C27H16Cl2F6N4O2 |
| Molecular Weight | 613.35 g/mol |
| Exact Mass | 612.06 |
| IUPAC Name | 4,6-bis[4-chloro-3-(trifluoromethyl)phenoxy]-2-(1-methylindol-6-yl)pyrimidin-5-amine |
| SMILES | Cn1ccc2ccc(-c3nc(Oc4ccc(Cl)c(C(F)(F)F)c4)c(N)c(Oc4ccc(Cl)c(C(F)(F)F)c4)n3)cc21 |
| InChI | InChI=1S/C27H16Cl2F6N4O2/c1-39-9-8-13-2-3-14(10-21(13)39)23-37-24(40-15-4-6-19(28)17(11-15)26(30,31)32)22(36)25(38-23)41-16-5-7-20(29)18(12-16)27(33,34)35/h2-12H,36H2,1H3 |
| InChIKey | XPVQJOLZWSMTCN-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.35 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |