C14H7ClF3N3O3 — CID 66940256
2-[4-chloro-3-(trifluoromethyl)phenoxy]-6-methyl-5-nitropyridine-3-carbonitrile (PubChem CID 66940256) has the molecular formula C14H7ClF3N3O3 and a molecular weight of 357.68 g/mol. Its IUPAC name is 2-[4-chloro-3-(trifluoromethyl)phenoxy]-6-methyl-5-nitropyridine-3-carbonitrile.
| Compound Name | 2-[4-chloro-3-(trifluoromethyl)phenoxy]-6-methyl-5-nitropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 66940256 |
| Molecular Formula | C14H7ClF3N3O3 |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 2-[4-chloro-3-(trifluoromethyl)phenoxy]-6-methyl-5-nitropyridine-3-carbonitrile |
| SMILES | Cc1nc(Oc2ccc(Cl)c(C(F)(F)F)c2)c(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H7ClF3N3O3/c1-7-12(21(22)23)4-8(6-19)13(20-7)24-9-2-3-11(15)10(5-9)14(16,17)18/h2-5H,1H3 |
| InChIKey | QLLQGTZIHHOYAP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|