C26H15Br2Cl3F6N4O6 — CID 158938626
3-bromo-2-chloro-4-methyl-5-nitropyridine;3-bromo-2-[4-chloro-3-(trifluoromethyl)phenoxy]-4-methyl-5-nitropyridine;4-chloro-3-(trifluoromethyl)phenol (PubChem CID 158938626) has the molecular formula C26H15Br2Cl3F6N4O6 and a molecular weight of 859.58 g/mol. Its IUPAC name is 3-bromo-2-chloro-4-methyl-5-nitropyridine;3-bromo-2-[4-chloro-3-(trifluoromethyl)phenoxy]-4-methyl-5-nitropyridine;4-chloro-3-(trifluoromethyl)phenol.
| Compound Name | 3-bromo-2-chloro-4-methyl-5-nitropyridine;3-bromo-2-[4-chloro-3-(trifluoromethyl)phenoxy]-4-methyl-5-nitropyridine;4-chloro-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 158938626 |
| Molecular Formula | C26H15Br2Cl3F6N4O6 |
| Molecular Weight | 859.58 g/mol |
| Exact Mass | 855.83 |
| IUPAC Name | 3-bromo-2-chloro-4-methyl-5-nitropyridine;3-bromo-2-[4-chloro-3-(trifluoromethyl)phenoxy]-4-methyl-5-nitropyridine;4-chloro-3-(trifluoromethyl)phenol |
| SMILES | Cc1c([N+](=O)[O-])cnc(Cl)c1Br.Cc1c([N+](=O)[O-])cnc(Oc2ccc(Cl)c(C(F)(F)F)c2)c1Br.Oc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H7BrClF3N2O3.C7H4ClF3O.C6H4BrClN2O2/c1-6-10(20(21)22)5-19-12(11(6)14)23-7-2-3-9(15)8(4-7)13(16,17)18;8-6-2-1-4(12)3-5(6)7(9,10)11;1-3-4(10(11)12)2-9-6(8)5(3)7/h2-5H,1H3;1-3,12H;2H,1H3 |
| InChIKey | JJYSVEDGGBUPCM-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.58 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|