C13H5BrClF6NO4 — CID 158746039
2-bromo-3,4,5-trifluoro-6-nitrophenol;4-chloro-3-(trifluoromethyl)phenol (PubChem CID 158746039) has the molecular formula C13H5BrClF6NO4 and a molecular weight of 468.53 g/mol. Its IUPAC name is 2-bromo-3,4,5-trifluoro-6-nitrophenol;4-chloro-3-(trifluoromethyl)phenol.
| Compound Name | 2-bromo-3,4,5-trifluoro-6-nitrophenol;4-chloro-3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 158746039 |
| Molecular Formula | C13H5BrClF6NO4 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 466.90 |
| IUPAC Name | 2-bromo-3,4,5-trifluoro-6-nitrophenol;4-chloro-3-(trifluoromethyl)phenol |
| SMILES | O=[N+]([O-])c1c(O)c(Br)c(F)c(F)c1F.Oc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C7H4ClF3O.C6HBrF3NO3/c8-6-2-1-4(12)3-5(6)7(9,10)11;7-1-2(8)3(9)4(10)5(6(1)12)11(13)14/h1-3,12H;12H |
| InChIKey | IMWYUHYIZHZUDD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|