C14H6Cl2F3NO — CID 43320716
4-(2,5-dichlorophenoxy)-2-(trifluoromethyl)benzonitrile (PubChem CID 43320716) has the molecular formula C14H6Cl2F3NO and a molecular weight of 332.11 g/mol. Its IUPAC name is 4-(2,5-dichlorophenoxy)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(2,5-dichlorophenoxy)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 43320716 |
| Molecular Formula | C14H6Cl2F3NO |
| Molecular Weight | 332.11 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 4-(2,5-dichlorophenoxy)-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Oc2cc(Cl)ccc2Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C14H6Cl2F3NO/c15-9-2-4-12(16)13(5-9)21-10-3-1-8(7-20)11(6-10)14(17,18)19/h1-6H |
| InChIKey | ONPQXWJBRMSRHL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.11 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |