C26H27NO3S — CID 24894818
[(1S)-2-azabicyclo[2.2.1]heptan-7-yl] 2-(3-hydroxythiophen-2-yl)-2,3-diphenylbutanoate (PubChem CID 24894818) has the molecular formula C26H27NO3S and a molecular weight of 433.57 g/mol. Its IUPAC name is [(1S)-2-azabicyclo[2.2.1]heptan-7-yl] 2-(3-hydroxythiophen-2-yl)-2,3-diphenylbutanoate.
| Compound Name | [(1S)-2-azabicyclo[2.2.1]heptan-7-yl] 2-(3-hydroxythiophen-2-yl)-2,3-diphenylbutanoate |
|---|---|
| PubChem CID | 24894818 |
| Molecular Formula | C26H27NO3S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [(1S)-2-azabicyclo[2.2.1]heptan-7-yl] 2-(3-hydroxythiophen-2-yl)-2,3-diphenylbutanoate |
| SMILES | CC(c1ccccc1)C(C(=O)OC1C2CC[C@@H]1NC2)(c1ccccc1)c1sccc1O |
| InChI | InChI=1S/C26H27NO3S/c1-17(18-8-4-2-5-9-18)26(20-10-6-3-7-11-20,24-22(28)14-15-31-24)25(29)30-23-19-12-13-21(23)27-16-19/h2-11,14-15,17,19,21,23,27-28H,12-13,16H2,1H3/t17?,19?,21-,23?,26?/m0/s1 |
| InChIKey | JTXJCJZHEXVYCO-LEDXRGQXSA-N |
| XLogP | 4.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|