C15H10F4N2OS — CID 24899391
2,3,4,5-tetrafluoro-N-[(4-methylphenyl)carbamothioyl]benzamide (PubChem CID 24899391) has the molecular formula C15H10F4N2OS and a molecular weight of 342.32 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[(4-methylphenyl)carbamothioyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[(4-methylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 24899391 |
| Molecular Formula | C15H10F4N2OS |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[(4-methylphenyl)carbamothioyl]benzamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)c2cc(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H10F4N2OS/c1-7-2-4-8(5-3-7)20-15(23)21-14(22)9-6-10(16)12(18)13(19)11(9)17/h2-6H,1H3,(H2,20,21,22,23) |
| InChIKey | JSKWCDOVWIMEPZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|