C23H28N4O6S2 — CID 24901379
N'-[3-[2-(2,6-dimethoxybenzoyl)-2-methylhydrazinyl]-3-sulfanylidenepropanethioyl]-2,6-dimethoxy-N-methylbenzohydrazide (PubChem CID 24901379) has the molecular formula C23H28N4O6S2 and a molecular weight of 520.63 g/mol. Its IUPAC name is N'-[3-[2-(2,6-dimethoxybenzoyl)-2-methylhydrazinyl]-3-sulfanylidenepropanethioyl]-2,6-dimethoxy-N-methylbenzohydrazide.
| Compound Name | N'-[3-[2-(2,6-dimethoxybenzoyl)-2-methylhydrazinyl]-3-sulfanylidenepropanethioyl]-2,6-dimethoxy-N-methylbenzohydrazide |
|---|---|
| PubChem CID | 24901379 |
| Molecular Formula | C23H28N4O6S2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | N'-[3-[2-(2,6-dimethoxybenzoyl)-2-methylhydrazinyl]-3-sulfanylidenepropanethioyl]-2,6-dimethoxy-N-methylbenzohydrazide |
| SMILES | COc1cccc(OC)c1C(=O)N(C)NC(=S)CC(=S)NN(C)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C23H28N4O6S2/c1-26(22(28)20-14(30-3)9-7-10-15(20)31-4)24-18(34)13-19(35)25-27(2)23(29)21-16(32-5)11-8-12-17(21)33-6/h7-12H,13H2,1-6H3,(H,24,34)(H,25,35) |
| InChIKey | UJIUPNZZVGHFMH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|