C18H21N3O3 — CID 24901627
(2S)-2-amino-N'-[4-(4-methylphenoxy)phenyl]pentanediamide (PubChem CID 24901627) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2S)-2-amino-N'-[4-(4-methylphenoxy)phenyl]pentanediamide.
| Compound Name | (2S)-2-amino-N'-[4-(4-methylphenoxy)phenyl]pentanediamide |
|---|---|
| PubChem CID | 24901627 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (2S)-2-amino-N'-[4-(4-methylphenoxy)phenyl]pentanediamide |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)CC[C@H](N)C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-2-6-14(7-3-12)24-15-8-4-13(5-9-15)21-17(22)11-10-16(19)18(20)23/h2-9,16H,10-11,19H2,1H3,(H2,20,23)(H,21,22)/t16-/m0/s1 |
| InChIKey | SNPCQHHCCJNFNQ-INIZCTEOSA-N |
| XLogP | 2.32 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |