C22H19NO4S — CID 24902260
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-3-ylpropanoic acid (PubChem CID 24902260) has the molecular formula C22H19NO4S and a molecular weight of 393.46 g/mol. Its IUPAC name is 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-3-ylpropanoic acid.
| Compound Name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-3-ylpropanoic acid |
|---|---|
| PubChem CID | 24902260 |
| Molecular Formula | C22H19NO4S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-3-ylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)c1ccsc1 |
| InChI | InChI=1S/C22H19NO4S/c24-21(25)11-20(14-9-10-28-13-14)23-22(26)27-12-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-10,13,19-20H,11-12H2,(H,23,26)(H,24,25) |
| InChIKey | FQLMDOMRTRHLFX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |